About 3-(thieno[3,2-d]pyrimidin-4-yloxymethyl)pentan-3-amine
3-(thieno[3,2-d]pyrimidin-4-yloxymethyl)pentan-3-amine (PubChem CID 64574048) has the molecular formula C12H17N3OS
and a molecular weight of 251.35 g/mol. Its IUPAC name is 3-(thieno[3,2-d]pyrimidin-4-yloxymethyl)pentan-3-amine.
Molecular Properties
| Compound Name | 3-(thieno[3,2-d]pyrimidin-4-yloxymethyl)pentan-3-amine |
| PubChem CID | 64574048 |
| Molecular Formula | C12H17N3OS |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 3-(thieno[3,2-d]pyrimidin-4-yloxymethyl)pentan-3-amine |
| SMILES | CCC(N)(CC)COc1ncnc2ccsc12 |
| InChI | InChI=1S/C12H17N3OS/c1-3-12(13,4-2)7-16-11-10-9(5-6-17-10)14-8-15-11/h5-6,8H,3-4,7,13H2,1-2H3 |
| InChIKey | FEXQEOPUWSYFHA-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(thieno[3,2-d]pyrimidin-4-yloxymethyl)pentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(thieno[3,2-d]pyrimidin-4-yloxymethyl)pentan-3-amine?
The IUPAC name of 3-(thieno[3,2-d]pyrimidin-4-yloxymethyl)pentan-3-amine (CID 64574048) is 3-(thieno[3,2-d]pyrimidin-4-yloxymethyl)pentan-3-amine.
What is the SMILES notation for 3-(thieno[3,2-d]pyrimidin-4-yloxymethyl)pentan-3-amine?
The canonical SMILES for 3-(thieno[3,2-d]pyrimidin-4-yloxymethyl)pentan-3-amine is CCC(N)(CC)COc1ncnc2ccsc12.
What is the InChIKey of 3-(thieno[3,2-d]pyrimidin-4-yloxymethyl)pentan-3-amine?
The InChIKey is FEXQEOPUWSYFHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3OS/c1-3-12(13,4-2)7-16-11-10-9(5-6-17-10)14-8-15-11/h5-6,8H,3-4,7,13H2,1-2H3.
What are the key properties of 3-(thieno[3,2-d]pyrimidin-4-yloxymethyl)pentan-3-amine?
3-(thieno[3,2-d]pyrimidin-4-yloxymethyl)pentan-3-amine has a molecular weight of 251.35 g/mol, XLogP of 2.59, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(thieno[3,2-d]pyrimidin-4-yloxymethyl)pentan-3-amine is sourced from PubChem (CID 64574048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).