C6H9F3N4OS — CID 64574311
3-amino-4-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazole-5-thione (PubChem CID 64574311) has the molecular formula C6H9F3N4OS and a molecular weight of 242.23 g/mol. Its IUPAC name is 3-amino-4-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-amino-4-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 64574311 |
| Molecular Formula | C6H9F3N4OS |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 3-amino-4-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-1,2,4-triazole-5-thione |
| SMILES | Nc1n[nH]c(=S)n1CCOCC(F)(F)F |
| InChI | InChI=1S/C6H9F3N4OS/c7-6(8,9)3-14-2-1-13-4(10)11-12-5(13)15/h1-3H2,(H2,10,11)(H,12,15) |
| InChIKey | STNFZHHMCFNCSW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 68.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|