C12H12F3N5 — CID 64574998
3-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]aniline (PubChem CID 64574998) has the molecular formula C12H12F3N5 and a molecular weight of 283.26 g/mol. Its IUPAC name is 3-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]aniline.
| Compound Name | 3-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]aniline |
|---|---|
| PubChem CID | 64574998 |
| Molecular Formula | C12H12F3N5 |
| Molecular Weight | 283.26 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 3-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]aniline |
| SMILES | Nc1cccc(N2CCn3c(nnc3C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C12H12F3N5/c13-12(14,15)11-18-17-10-7-19(4-5-20(10)11)9-3-1-2-8(16)6-9/h1-3,6H,4-5,7,16H2 |
| InChIKey | CYSHNNINKBOTIC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.26 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|