C10H16F3N5 — CID 64575120
2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-1,1,1-trifluoropentan-3-amine (PubChem CID 64575120) has the molecular formula C10H16F3N5 and a molecular weight of 263.27 g/mol. Its IUPAC name is 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-1,1,1-trifluoropentan-3-amine.
| Compound Name | 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-1,1,1-trifluoropentan-3-amine |
|---|---|
| PubChem CID | 64575120 |
| Molecular Formula | C10H16F3N5 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-1,1,1-trifluoropentan-3-amine |
| SMILES | CCC(N)C(N1CCn2cnnc2C1)C(F)(F)F |
| InChI | InChI=1S/C10H16F3N5/c1-2-7(14)9(10(11,12)13)17-3-4-18-6-15-16-8(18)5-17/h6-7,9H,2-5,14H2,1H3 |
| InChIKey | PZBVEOGELFYSGL-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |