C9H12N4O3 — CID 64575480
ethyl 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2-oxoacetate (PubChem CID 64575480) has the molecular formula C9H12N4O3 and a molecular weight of 224.22 g/mol. Its IUPAC name is ethyl 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2-oxoacetate.
| Compound Name | ethyl 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 64575480 |
| Molecular Formula | C9H12N4O3 |
| Molecular Weight | 224.22 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | ethyl 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)N1CCn2cnnc2C1 |
| InChI | InChI=1S/C9H12N4O3/c1-2-16-9(15)8(14)12-3-4-13-6-10-11-7(13)5-12/h6H,2-5H2,1H3 |
| InChIKey | FWARKCJJXIMNBG-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.22 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|