C12H14FN5 — CID 64575501
2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-ylmethyl)-4-fluoroaniline (PubChem CID 64575501) has the molecular formula C12H14FN5 and a molecular weight of 247.28 g/mol. Its IUPAC name is 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-ylmethyl)-4-fluoroaniline.
| Compound Name | 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-ylmethyl)-4-fluoroaniline |
|---|---|
| PubChem CID | 64575501 |
| Molecular Formula | C12H14FN5 |
| Molecular Weight | 247.28 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-ylmethyl)-4-fluoroaniline |
| SMILES | Nc1ccc(F)cc1CN1CCn2cnnc2C1 |
| InChI | InChI=1S/C12H14FN5/c13-10-1-2-11(14)9(5-10)6-17-3-4-18-8-15-16-12(18)7-17/h1-2,5,8H,3-4,6-7,14H2 |
| InChIKey | PIPBBHBFFNIEJJ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.28 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|