C11H17F3N6 — CID 64575634
N'-(2-methylpropyl)-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboximidamide (PubChem CID 64575634) has the molecular formula C11H17F3N6 and a molecular weight of 290.29 g/mol. Its IUPAC name is N'-(2-methylpropyl)-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboximidamide.
| Compound Name | N'-(2-methylpropyl)-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboximidamide |
|---|---|
| PubChem CID | 64575634 |
| Molecular Formula | C11H17F3N6 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | N'-(2-methylpropyl)-3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazine-7-carboximidamide |
| SMILES | CC(C)C/N=C(\N)N1CCn2c(nnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C11H17F3N6/c1-7(2)5-16-10(15)19-3-4-20-8(6-19)17-18-9(20)11(12,13)14/h7H,3-6H2,1-2H3,(H2,15,16) |
| InChIKey | SMKLYLHCRMFZCF-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 72.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|