C13H17N7S — CID 64575731
N-[[6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]ethanamine (PubChem CID 64575731) has the molecular formula C13H17N7S and a molecular weight of 303.39 g/mol. Its IUPAC name is N-[[6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]ethanamine.
| Compound Name | N-[[6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 64575731 |
| Molecular Formula | C13H17N7S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N-[[6-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)imidazo[2,1-b][1,3]thiazol-5-yl]methyl]ethanamine |
| SMILES | CCNCc1c(N2CCn3cnnc3C2)nc2sccn12 |
| InChI | InChI=1S/C13H17N7S/c1-2-14-7-10-12(16-13-20(10)5-6-21-13)18-3-4-19-9-15-17-11(19)8-18/h5-6,9,14H,2-4,7-8H2,1H3 |
| InChIKey | VHAPMSWHDSRUAK-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 63.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |