C9H14F3N5 — CID 64575886
3-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-4,4,4-trifluorobutan-1-amine (PubChem CID 64575886) has the molecular formula C9H14F3N5 and a molecular weight of 249.24 g/mol. Its IUPAC name is 3-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-4,4,4-trifluorobutan-1-amine.
| Compound Name | 3-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 64575886 |
| Molecular Formula | C9H14F3N5 |
| Molecular Weight | 249.24 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 3-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-4,4,4-trifluorobutan-1-amine |
| SMILES | NCCC(N1CCn2cnnc2C1)C(F)(F)F |
| InChI | InChI=1S/C9H14F3N5/c10-9(11,12)7(1-2-13)16-3-4-17-6-14-15-8(17)5-16/h6-7H,1-5,13H2 |
| InChIKey | PPLDXKSHXHNJNU-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.24 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |