C14H18FN5O — CID 64575965
2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-5-fluoro-4-propoxyaniline (PubChem CID 64575965) has the molecular formula C14H18FN5O and a molecular weight of 291.33 g/mol. Its IUPAC name is 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-5-fluoro-4-propoxyaniline.
| Compound Name | 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-5-fluoro-4-propoxyaniline |
|---|---|
| PubChem CID | 64575965 |
| Molecular Formula | C14H18FN5O |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-5-fluoro-4-propoxyaniline |
| SMILES | CCCOc1cc(N2CCn3cnnc3C2)c(N)cc1F |
| InChI | InChI=1S/C14H18FN5O/c1-2-5-21-13-7-12(11(16)6-10(13)15)19-3-4-20-9-17-18-14(20)8-19/h6-7,9H,2-5,8,16H2,1H3 |
| InChIKey | YHWMBJCYGPERCB-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|