C10H14F3N5S — CID 64576137
3-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butanethioamide (PubChem CID 64576137) has the molecular formula C10H14F3N5S and a molecular weight of 293.32 g/mol. Its IUPAC name is 3-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butanethioamide.
| Compound Name | 3-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butanethioamide |
|---|---|
| PubChem CID | 64576137 |
| Molecular Formula | C10H14F3N5S |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 3-[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]butanethioamide |
| SMILES | CC(CC(N)=S)N1CCn2c(nnc2C(F)(F)F)C1 |
| InChI | InChI=1S/C10H14F3N5S/c1-6(4-7(14)19)17-2-3-18-8(5-17)15-16-9(18)10(11,12)13/h6H,2-5H2,1H3,(H2,14,19) |
| InChIKey | BDCACXZHMBTCME-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|