C17H26N2O4S2 — CID 645768
N-(2-methylcyclohexyl)-4-pyrrolidin-1-ylsulfonylbenzenesulfonamide (PubChem CID 645768) has the molecular formula C17H26N2O4S2 and a molecular weight of 386.54 g/mol. Its IUPAC name is N-(2-methylcyclohexyl)-4-pyrrolidin-1-ylsulfonylbenzenesulfonamide.
| Compound Name | N-(2-methylcyclohexyl)-4-pyrrolidin-1-ylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 645768 |
| Molecular Formula | C17H26N2O4S2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | N-(2-methylcyclohexyl)-4-pyrrolidin-1-ylsulfonylbenzenesulfonamide |
| SMILES | CC1CCCCC1NS(=O)(=O)c1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C17H26N2O4S2/c1-14-6-2-3-7-17(14)18-24(20,21)15-8-10-16(11-9-15)25(22,23)19-12-4-5-13-19/h8-11,14,17-18H,2-7,12-13H2,1H3 |
| InChIKey | KIRUQSXYMWHYEN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |