C9H16N6 — CID 64576874
2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)butanimidamide (PubChem CID 64576874) has the molecular formula C9H16N6 and a molecular weight of 208.27 g/mol. Its IUPAC name is 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)butanimidamide.
| Compound Name | 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)butanimidamide |
|---|---|
| PubChem CID | 64576874 |
| Molecular Formula | C9H16N6 |
| Molecular Weight | 208.27 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)butanimidamide |
| SMILES | [H]/N=C(\N)C(CC)N1CCn2cnnc2C1 |
| InChI | InChI=1S/C9H16N6/c1-2-7(9(10)11)14-3-4-15-6-12-13-8(15)5-14/h6-7H,2-5H2,1H3,(H3,10,11) |
| InChIKey | LYWWZKQOUNYCGN-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.27 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|