C14H18BrN5 — CID 64577052
1-[3-bromo-4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)phenyl]-N-methylethanamine (PubChem CID 64577052) has the molecular formula C14H18BrN5 and a molecular weight of 336.24 g/mol. Its IUPAC name is 1-[3-bromo-4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)phenyl]-N-methylethanamine.
| Compound Name | 1-[3-bromo-4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)phenyl]-N-methylethanamine |
|---|---|
| PubChem CID | 64577052 |
| Molecular Formula | C14H18BrN5 |
| Molecular Weight | 336.24 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 1-[3-bromo-4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)phenyl]-N-methylethanamine |
| SMILES | CNC(C)c1ccc(N2CCn3cnnc3C2)c(Br)c1 |
| InChI | InChI=1S/C14H18BrN5/c1-10(16-2)11-3-4-13(12(15)7-11)19-5-6-20-9-17-18-14(20)8-19/h3-4,7,9-10,16H,5-6,8H2,1-2H3 |
| InChIKey | OXRLSRGSVSLTOX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.24 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|