C12H12F2N4O — CID 64577084
[4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-3,5-difluorophenyl]methanol (PubChem CID 64577084) has the molecular formula C12H12F2N4O and a molecular weight of 266.25 g/mol. Its IUPAC name is [4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-3,5-difluorophenyl]methanol.
| Compound Name | [4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-3,5-difluorophenyl]methanol |
|---|---|
| PubChem CID | 64577084 |
| Molecular Formula | C12H12F2N4O |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | [4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-3,5-difluorophenyl]methanol |
| SMILES | OCc1cc(F)c(N2CCn3cnnc3C2)c(F)c1 |
| InChI | InChI=1S/C12H12F2N4O/c13-9-3-8(6-19)4-10(14)12(9)17-1-2-18-7-15-16-11(18)5-17/h3-4,7,19H,1-2,5-6H2 |
| InChIKey | LQYWQUIAFLMFJD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|