About N-cyclopropyl-4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzenesulfonamide
N-cyclopropyl-4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzenesulfonamide (PubChem CID 645771) has the molecular formula C18H20N2O4S2
and a molecular weight of 392.50 g/mol. Its IUPAC name is N-cyclopropyl-4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-cyclopropyl-4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzenesulfonamide |
| PubChem CID | 645771 |
| Molecular Formula | C18H20N2O4S2 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | N-cyclopropyl-4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzenesulfonamide |
| SMILES | O=S(=O)(NC1CC1)c1ccc(S(=O)(=O)N2CCCc3ccccc32)cc1 |
| InChI | InChI=1S/C18H20N2O4S2/c21-25(22,19-15-7-8-15)16-9-11-17(12-10-16)26(23,24)20-13-3-5-14-4-1-2-6-18(14)20/h1-2,4,6,9-12,15,19H,3,5,7-8,13H2 |
| InChIKey | NDSGBWBSYKPKKT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-cyclopropyl-4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzenesulfonamide?
The IUPAC name of N-cyclopropyl-4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzenesulfonamide (CID 645771) is N-cyclopropyl-4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzenesulfonamide.
What is the SMILES notation for N-cyclopropyl-4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzenesulfonamide?
The canonical SMILES for N-cyclopropyl-4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzenesulfonamide is O=S(=O)(NC1CC1)c1ccc(S(=O)(=O)N2CCCc3ccccc32)cc1.
What is the InChIKey of N-cyclopropyl-4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzenesulfonamide?
The InChIKey is NDSGBWBSYKPKKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N2O4S2/c21-25(22,19-15-7-8-15)16-9-11-17(12-10-16)26(23,24)20-13-3-5-14-4-1-2-6-18(14)20/h1-2,4,6,9-12,15,19H,3,5,7-8,13H2.
What are the key properties of N-cyclopropyl-4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzenesulfonamide?
N-cyclopropyl-4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzenesulfonamide has a molecular weight of 392.50 g/mol, XLogP of 2.27, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)benzenesulfonamide is sourced from PubChem (CID 645771), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).