C12H13FN4O — CID 64577258
[4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-3-fluorophenyl]methanol (PubChem CID 64577258) has the molecular formula C12H13FN4O and a molecular weight of 248.26 g/mol. Its IUPAC name is [4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-3-fluorophenyl]methanol.
| Compound Name | [4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-3-fluorophenyl]methanol |
|---|---|
| PubChem CID | 64577258 |
| Molecular Formula | C12H13FN4O |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | [4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-3-fluorophenyl]methanol |
| SMILES | OCc1ccc(N2CCn3cnnc3C2)c(F)c1 |
| InChI | InChI=1S/C12H13FN4O/c13-10-5-9(7-18)1-2-11(10)16-3-4-17-8-14-15-12(17)6-16/h1-2,5,8,18H,3-4,6-7H2 |
| InChIKey | ZMMYVLQIPPCOKM-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 54.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|