C15H20FN5 — CID 64578232
N-[[4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-3-fluorophenyl]methyl]propan-1-amine (PubChem CID 64578232) has the molecular formula C15H20FN5 and a molecular weight of 289.36 g/mol. Its IUPAC name is N-[[4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-3-fluorophenyl]methyl]propan-1-amine.
| Compound Name | N-[[4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-3-fluorophenyl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 64578232 |
| Molecular Formula | C15H20FN5 |
| Molecular Weight | 289.36 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | N-[[4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-3-fluorophenyl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(N2CCn3cnnc3C2)c(F)c1 |
| InChI | InChI=1S/C15H20FN5/c1-2-5-17-9-12-3-4-14(13(16)8-12)20-6-7-21-11-18-19-15(21)10-20/h3-4,8,11,17H,2,5-7,9-10H2,1H3 |
| InChIKey | ODAMOULREOGOEJ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|