C11H18N6O2 — CID 64578509
5-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-ylmethyl)oxolane-2-carbohydrazide (PubChem CID 64578509) has the molecular formula C11H18N6O2 and a molecular weight of 266.30 g/mol. Its IUPAC name is 5-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-ylmethyl)oxolane-2-carbohydrazide.
| Compound Name | 5-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-ylmethyl)oxolane-2-carbohydrazide |
|---|---|
| PubChem CID | 64578509 |
| Molecular Formula | C11H18N6O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 5-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-ylmethyl)oxolane-2-carbohydrazide |
| SMILES | NNC(=O)C1CCC(CN2CCn3cnnc3C2)O1 |
| InChI | InChI=1S/C11H18N6O2/c12-14-11(18)9-2-1-8(19-9)5-16-3-4-17-7-13-15-10(17)6-16/h7-9H,1-6,12H2,(H,14,18) |
| InChIKey | YWKJMHBWFDPQEE-UHFFFAOYSA-N |
| XLogP | -1.37 |
| TPSA | 98.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|