About ethyl 4-(1,2,4-oxadiazol-3-ylmethylamino)butanoate
ethyl 4-(1,2,4-oxadiazol-3-ylmethylamino)butanoate (PubChem CID 64578576) has the molecular formula C9H15N3O3
and a molecular weight of 213.24 g/mol. Its IUPAC name is ethyl 4-(1,2,4-oxadiazol-3-ylmethylamino)butanoate.
Molecular Properties
| Compound Name | ethyl 4-(1,2,4-oxadiazol-3-ylmethylamino)butanoate |
| PubChem CID | 64578576 |
| Molecular Formula | C9H15N3O3 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.11 |
| IUPAC Name | ethyl 4-(1,2,4-oxadiazol-3-ylmethylamino)butanoate |
| SMILES | CCOC(=O)CCCNCc1ncon1 |
| InChI | InChI=1S/C9H15N3O3/c1-2-14-9(13)4-3-5-10-6-8-11-7-15-12-8/h7,10H,2-6H2,1H3 |
| InChIKey | CKNUKDRTCOVWDK-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 77.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-(1,2,4-oxadiazol-3-ylmethylamino)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(1,2,4-oxadiazol-3-ylmethylamino)butanoate?
The IUPAC name of ethyl 4-(1,2,4-oxadiazol-3-ylmethylamino)butanoate (CID 64578576) is ethyl 4-(1,2,4-oxadiazol-3-ylmethylamino)butanoate.
What is the SMILES notation for ethyl 4-(1,2,4-oxadiazol-3-ylmethylamino)butanoate?
The canonical SMILES for ethyl 4-(1,2,4-oxadiazol-3-ylmethylamino)butanoate is CCOC(=O)CCCNCc1ncon1.
What is the InChIKey of ethyl 4-(1,2,4-oxadiazol-3-ylmethylamino)butanoate?
The InChIKey is CKNUKDRTCOVWDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15N3O3/c1-2-14-9(13)4-3-5-10-6-8-11-7-15-12-8/h7,10H,2-6H2,1H3.
What are the key properties of ethyl 4-(1,2,4-oxadiazol-3-ylmethylamino)butanoate?
ethyl 4-(1,2,4-oxadiazol-3-ylmethylamino)butanoate has a molecular weight of 213.24 g/mol, XLogP of 0.50, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(1,2,4-oxadiazol-3-ylmethylamino)butanoate is sourced from PubChem (CID 64578576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).