C15H16N4S — CID 6457878
4-cyclohexylsulfanyl-[1,2,4]triazolo[4,3-a]quinoxaline (PubChem CID 6457878) has the molecular formula C15H16N4S and a molecular weight of 284.39 g/mol. Its IUPAC name is 4-cyclohexylsulfanyl-[1,2,4]triazolo[4,3-a]quinoxaline.
| Compound Name | 4-cyclohexylsulfanyl-[1,2,4]triazolo[4,3-a]quinoxaline |
|---|---|
| PubChem CID | 6457878 |
| Molecular Formula | C15H16N4S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 4-cyclohexylsulfanyl-[1,2,4]triazolo[4,3-a]quinoxaline |
| SMILES | c1ccc2c(c1)nc(SC1CCCCC1)c1nncn12 |
| InChI | InChI=1S/C15H16N4S/c1-2-6-11(7-3-1)20-15-14-18-16-10-19(14)13-9-5-4-8-12(13)17-15/h4-5,8-11H,1-3,6-7H2 |
| InChIKey | UXSVKOSMOYBNDI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |