C12H23N5O — CID 64579080
4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-N-(2-methoxyethyl)butan-1-amine (PubChem CID 64579080) has the molecular formula C12H23N5O and a molecular weight of 253.35 g/mol. Its IUPAC name is 4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-N-(2-methoxyethyl)butan-1-amine.
| Compound Name | 4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-N-(2-methoxyethyl)butan-1-amine |
|---|---|
| PubChem CID | 64579080 |
| Molecular Formula | C12H23N5O |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.19 |
| IUPAC Name | 4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-N-(2-methoxyethyl)butan-1-amine |
| SMILES | COCCNCCCCN1CCn2cnnc2C1 |
| InChI | InChI=1S/C12H23N5O/c1-18-9-5-13-4-2-3-6-16-7-8-17-11-14-15-12(17)10-16/h11,13H,2-10H2,1H3 |
| InChIKey | SCXQKQFKXHINOY-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|