C13H25N5 — CID 64579251
1-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-N,4,4-trimethylpentan-3-amine (PubChem CID 64579251) has the molecular formula C13H25N5 and a molecular weight of 251.38 g/mol. Its IUPAC name is 1-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-N,4,4-trimethylpentan-3-amine.
| Compound Name | 1-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-N,4,4-trimethylpentan-3-amine |
|---|---|
| PubChem CID | 64579251 |
| Molecular Formula | C13H25N5 |
| Molecular Weight | 251.38 g/mol |
| Exact Mass | 251.21 |
| IUPAC Name | 1-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-N,4,4-trimethylpentan-3-amine |
| SMILES | CNC(CCN1CCn2cnnc2C1)C(C)(C)C |
| InChI | InChI=1S/C13H25N5/c1-13(2,3)11(14-4)5-6-17-7-8-18-10-15-16-12(18)9-17/h10-11,14H,5-9H2,1-4H3 |
| InChIKey | SPRHPYYTVDJBOB-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |