C14H18FN5 — CID 64579788
N-[[4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-3-fluorophenyl]methyl]ethanamine (PubChem CID 64579788) has the molecular formula C14H18FN5 and a molecular weight of 275.33 g/mol. Its IUPAC name is N-[[4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-3-fluorophenyl]methyl]ethanamine.
| Compound Name | N-[[4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-3-fluorophenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 64579788 |
| Molecular Formula | C14H18FN5 |
| Molecular Weight | 275.33 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | N-[[4-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl)-3-fluorophenyl]methyl]ethanamine |
| SMILES | CCNCc1ccc(N2CCn3cnnc3C2)c(F)c1 |
| InChI | InChI=1S/C14H18FN5/c1-2-16-8-11-3-4-13(12(15)7-11)19-5-6-20-10-17-18-14(20)9-19/h3-4,7,10,16H,2,5-6,8-9H2,1H3 |
| InChIKey | IJUVUAPGWWZSDR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.33 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|