About ethyl 4-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)butanoate
ethyl 4-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)butanoate (PubChem CID 64580112) has the molecular formula C16H25NO3
and a molecular weight of 279.38 g/mol. Its IUPAC name is ethyl 4-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)butanoate.
Molecular Properties
| Compound Name | ethyl 4-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)butanoate |
| PubChem CID | 64580112 |
| Molecular Formula | C16H25NO3 |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.18 |
| IUPAC Name | ethyl 4-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)butanoate |
| SMILES | CCOC(=O)CCCn1ccc2c1CC(C)(C)CC2O |
| InChI | InChI=1S/C16H25NO3/c1-4-20-15(19)6-5-8-17-9-7-12-13(17)10-16(2,3)11-14(12)18/h7,9,14,18H,4-6,8,10-11H2,1-3H3 |
| InChIKey | JNYLYRASCKPXLT-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)butanoate?
The IUPAC name of ethyl 4-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)butanoate (CID 64580112) is ethyl 4-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)butanoate.
What is the SMILES notation for ethyl 4-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)butanoate?
The canonical SMILES for ethyl 4-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)butanoate is CCOC(=O)CCCn1ccc2c1CC(C)(C)CC2O.
What is the InChIKey of ethyl 4-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)butanoate?
The InChIKey is JNYLYRASCKPXLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25NO3/c1-4-20-15(19)6-5-8-17-9-7-12-13(17)10-16(2,3)11-14(12)18/h7,9,14,18H,4-6,8,10-11H2,1-3H3.
What are the key properties of ethyl 4-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)butanoate?
ethyl 4-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)butanoate has a molecular weight of 279.38 g/mol, XLogP of 2.84, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(4-hydroxy-6,6-dimethyl-5,7-dihydro-4H-indol-1-yl)butanoate is sourced from PubChem (CID 64580112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).