C15H29N5 — CID 64580209
2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-ylmethyl)-2-ethyl-N-propylbutan-1-amine (PubChem CID 64580209) has the molecular formula C15H29N5 and a molecular weight of 279.43 g/mol. Its IUPAC name is 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-ylmethyl)-2-ethyl-N-propylbutan-1-amine.
| Compound Name | 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-ylmethyl)-2-ethyl-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 64580209 |
| Molecular Formula | C15H29N5 |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.24 |
| IUPAC Name | 2-(6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-ylmethyl)-2-ethyl-N-propylbutan-1-amine |
| SMILES | CCCNCC(CC)(CC)CN1CCn2cnnc2C1 |
| InChI | InChI=1S/C15H29N5/c1-4-7-16-11-15(5-2,6-3)12-19-8-9-20-13-17-18-14(20)10-19/h13,16H,4-12H2,1-3H3 |
| InChIKey | XLYLIABBFQMVPV-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|