C16H22BrNO2 — CID 64580836
ethyl 4-[[3-(3-bromophenyl)cyclobutyl]amino]butanoate (PubChem CID 64580836) has the molecular formula C16H22BrNO2 and a molecular weight of 340.26 g/mol. Its IUPAC name is ethyl 4-[[3-(3-bromophenyl)cyclobutyl]amino]butanoate.
| Compound Name | ethyl 4-[[3-(3-bromophenyl)cyclobutyl]amino]butanoate |
|---|---|
| PubChem CID | 64580836 |
| Molecular Formula | C16H22BrNO2 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | ethyl 4-[[3-(3-bromophenyl)cyclobutyl]amino]butanoate |
| SMILES | CCOC(=O)CCCNC1CC(c2cccc(Br)c2)C1 |
| InChI | InChI=1S/C16H22BrNO2/c1-2-20-16(19)7-4-8-18-15-10-13(11-15)12-5-3-6-14(17)9-12/h3,5-6,9,13,15,18H,2,4,7-8,10-11H2,1H3 |
| InChIKey | ZSDZUOTXPMRPTC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|