About N-(1,1-dioxothiolan-3-yl)-2,2-diphenylacetamide
N-(1,1-dioxothiolan-3-yl)-2,2-diphenylacetamide (PubChem CID 6458135) has the molecular formula C18H19NO3S
and a molecular weight of 329.42 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2,2-diphenylacetamide.
Molecular Properties
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2,2-diphenylacetamide |
| PubChem CID | 6458135 |
| Molecular Formula | C18H19NO3S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2,2-diphenylacetamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H19NO3S/c20-18(19-16-11-12-23(21,22)13-16)17(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,16-17H,11-13H2,(H,19,20) |
| InChIKey | KKGINQXZNRFNSR-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(1,1-dioxothiolan-3-yl)-2,2-diphenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,1-dioxothiolan-3-yl)-2,2-diphenylacetamide?
The IUPAC name of N-(1,1-dioxothiolan-3-yl)-2,2-diphenylacetamide (CID 6458135) is N-(1,1-dioxothiolan-3-yl)-2,2-diphenylacetamide.
What is the SMILES notation for N-(1,1-dioxothiolan-3-yl)-2,2-diphenylacetamide?
The canonical SMILES for N-(1,1-dioxothiolan-3-yl)-2,2-diphenylacetamide is O=C(NC1CCS(=O)(=O)C1)C(c1ccccc1)c1ccccc1.
What is the InChIKey of N-(1,1-dioxothiolan-3-yl)-2,2-diphenylacetamide?
The InChIKey is KKGINQXZNRFNSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19NO3S/c20-18(19-16-11-12-23(21,22)13-16)17(14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,16-17H,11-13H2,(H,19,20).
What are the key properties of N-(1,1-dioxothiolan-3-yl)-2,2-diphenylacetamide?
N-(1,1-dioxothiolan-3-yl)-2,2-diphenylacetamide has a molecular weight of 329.42 g/mol, XLogP of 2.12, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,1-dioxothiolan-3-yl)-2,2-diphenylacetamide is sourced from PubChem (CID 6458135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).