C10H21N3O2 — CID 64583444
2-amino-3-[(1-methylpiperidin-4-yl)methylamino]propanoic acid (PubChem CID 64583444) has the molecular formula C10H21N3O2 and a molecular weight of 215.30 g/mol. Its IUPAC name is 2-amino-3-[(1-methylpiperidin-4-yl)methylamino]propanoic acid.
| Compound Name | 2-amino-3-[(1-methylpiperidin-4-yl)methylamino]propanoic acid |
|---|---|
| PubChem CID | 64583444 |
| Molecular Formula | C10H21N3O2 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.16 |
| IUPAC Name | 2-amino-3-[(1-methylpiperidin-4-yl)methylamino]propanoic acid |
| SMILES | CN1CCC(CNCC(N)C(=O)O)CC1 |
| InChI | InChI=1S/C10H21N3O2/c1-13-4-2-8(3-5-13)6-12-7-9(11)10(14)15/h8-9,12H,2-7,11H2,1H3,(H,14,15) |
| InChIKey | DWQZQDXDXLMCKO-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |