About 5-N-butyl-5-N-phenyl-1,3-benzothiazole-4,5-diamine
5-N-butyl-5-N-phenyl-1,3-benzothiazole-4,5-diamine (PubChem CID 64584206) has the molecular formula C17H19N3S
and a molecular weight of 297.43 g/mol. Its IUPAC name is 5-N-butyl-5-N-phenyl-1,3-benzothiazole-4,5-diamine.
Molecular Properties
| Compound Name | 5-N-butyl-5-N-phenyl-1,3-benzothiazole-4,5-diamine |
| PubChem CID | 64584206 |
| Molecular Formula | C17H19N3S |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | 5-N-butyl-5-N-phenyl-1,3-benzothiazole-4,5-diamine |
| SMILES | CCCCN(c1ccccc1)c1ccc2scnc2c1N |
| InChI | InChI=1S/C17H19N3S/c1-2-3-11-20(13-7-5-4-6-8-13)14-9-10-15-17(16(14)18)19-12-21-15/h4-10,12H,2-3,11,18H2,1H3 |
| InChIKey | NJJPSTVAUJEBOP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-N-butyl-5-N-phenyl-1,3-benzothiazole-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-N-butyl-5-N-phenyl-1,3-benzothiazole-4,5-diamine?
The IUPAC name of 5-N-butyl-5-N-phenyl-1,3-benzothiazole-4,5-diamine (CID 64584206) is 5-N-butyl-5-N-phenyl-1,3-benzothiazole-4,5-diamine.
What is the SMILES notation for 5-N-butyl-5-N-phenyl-1,3-benzothiazole-4,5-diamine?
The canonical SMILES for 5-N-butyl-5-N-phenyl-1,3-benzothiazole-4,5-diamine is CCCCN(c1ccccc1)c1ccc2scnc2c1N.
What is the InChIKey of 5-N-butyl-5-N-phenyl-1,3-benzothiazole-4,5-diamine?
The InChIKey is NJJPSTVAUJEBOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19N3S/c1-2-3-11-20(13-7-5-4-6-8-13)14-9-10-15-17(16(14)18)19-12-21-15/h4-10,12H,2-3,11,18H2,1H3.
What are the key properties of 5-N-butyl-5-N-phenyl-1,3-benzothiazole-4,5-diamine?
5-N-butyl-5-N-phenyl-1,3-benzothiazole-4,5-diamine has a molecular weight of 297.43 g/mol, XLogP of 4.82, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-N-butyl-5-N-phenyl-1,3-benzothiazole-4,5-diamine is sourced from PubChem (CID 64584206), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).