C22H34N6O3 — CID 645843
N-(furan-2-ylmethyl)-N-hexyl-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 645843) has the molecular formula C22H34N6O3 and a molecular weight of 430.55 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N-hexyl-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | N-(furan-2-ylmethyl)-N-hexyl-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 645843 |
| Molecular Formula | C22H34N6O3 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.27 |
| IUPAC Name | N-(furan-2-ylmethyl)-N-hexyl-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | CCCCCCN(Cc1ccco1)c1nc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C22H34N6O3/c1-2-3-4-5-8-28(18-19-7-6-13-31-19)22-24-20(26-9-14-29-15-10-26)23-21(25-22)27-11-16-30-17-12-27/h6-7,13H,2-5,8-12,14-18H2,1H3 |
| InChIKey | QBWARFHZPUDMOG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 79.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|