C9H15NO3S — CID 64584548
N-[(5-methylfuran-2-yl)methyl]propane-2-sulfonamide (PubChem CID 64584548) has the molecular formula C9H15NO3S and a molecular weight of 217.29 g/mol. Its IUPAC name is N-[(5-methylfuran-2-yl)methyl]propane-2-sulfonamide.
| Compound Name | N-[(5-methylfuran-2-yl)methyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 64584548 |
| Molecular Formula | C9H15NO3S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | N-[(5-methylfuran-2-yl)methyl]propane-2-sulfonamide |
| SMILES | Cc1ccc(CNS(=O)(=O)C(C)C)o1 |
| InChI | InChI=1S/C9H15NO3S/c1-7(2)14(11,12)10-6-9-5-4-8(3)13-9/h4-5,7,10H,6H2,1-3H3 |
| InChIKey | CUXFPQZLAIXENW-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |