C14H12FNO3 — CID 6458581
2-(4-fluorophenoxy)-N-(3-hydroxyphenyl)acetamide (PubChem CID 6458581) has the molecular formula C14H12FNO3 and a molecular weight of 261.25 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N-(3-hydroxyphenyl)acetamide.
| Compound Name | 2-(4-fluorophenoxy)-N-(3-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 6458581 |
| Molecular Formula | C14H12FNO3 |
| Molecular Weight | 261.25 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2-(4-fluorophenoxy)-N-(3-hydroxyphenyl)acetamide |
| SMILES | O=C(COc1ccc(F)cc1)Nc1cccc(O)c1 |
| InChI | InChI=1S/C14H12FNO3/c15-10-4-6-13(7-5-10)19-9-14(18)16-11-2-1-3-12(17)8-11/h1-8,17H,9H2,(H,16,18) |
| InChIKey | FCOALAGLFYCVKI-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.25 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |