About N-butyl-N'-cyclopropyl-2,2-dimethyl-N-phenylpropane-1,3-diamine
N-butyl-N'-cyclopropyl-2,2-dimethyl-N-phenylpropane-1,3-diamine (PubChem CID 64586599) has the molecular formula C18H30N2
and a molecular weight of 274.45 g/mol. Its IUPAC name is N-butyl-N'-cyclopropyl-2,2-dimethyl-N-phenylpropane-1,3-diamine.
Molecular Properties
| Compound Name | N-butyl-N'-cyclopropyl-2,2-dimethyl-N-phenylpropane-1,3-diamine |
| PubChem CID | 64586599 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | N-butyl-N'-cyclopropyl-2,2-dimethyl-N-phenylpropane-1,3-diamine |
| SMILES | CCCCN(CC(C)(C)CNC1CC1)c1ccccc1 |
| InChI | InChI=1S/C18H30N2/c1-4-5-13-20(17-9-7-6-8-10-17)15-18(2,3)14-19-16-11-12-16/h6-10,16,19H,4-5,11-15H2,1-3H3 |
| InChIKey | NJLYWHLMOVXHQB-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-butyl-N'-cyclopropyl-2,2-dimethyl-N-phenylpropane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butyl-N'-cyclopropyl-2,2-dimethyl-N-phenylpropane-1,3-diamine?
The IUPAC name of N-butyl-N'-cyclopropyl-2,2-dimethyl-N-phenylpropane-1,3-diamine (CID 64586599) is N-butyl-N'-cyclopropyl-2,2-dimethyl-N-phenylpropane-1,3-diamine.
What is the SMILES notation for N-butyl-N'-cyclopropyl-2,2-dimethyl-N-phenylpropane-1,3-diamine?
The canonical SMILES for N-butyl-N'-cyclopropyl-2,2-dimethyl-N-phenylpropane-1,3-diamine is CCCCN(CC(C)(C)CNC1CC1)c1ccccc1.
What is the InChIKey of N-butyl-N'-cyclopropyl-2,2-dimethyl-N-phenylpropane-1,3-diamine?
The InChIKey is NJLYWHLMOVXHQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N2/c1-4-5-13-20(17-9-7-6-8-10-17)15-18(2,3)14-19-16-11-12-16/h6-10,16,19H,4-5,11-15H2,1-3H3.
What are the key properties of N-butyl-N'-cyclopropyl-2,2-dimethyl-N-phenylpropane-1,3-diamine?
N-butyl-N'-cyclopropyl-2,2-dimethyl-N-phenylpropane-1,3-diamine has a molecular weight of 274.45 g/mol, XLogP of 4.07, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butyl-N'-cyclopropyl-2,2-dimethyl-N-phenylpropane-1,3-diamine is sourced from PubChem (CID 64586599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).