C13H15N3O2 — CID 64587416
ethyl 2-[(6-cyano-2-pyridinyl)-cyclopropylamino]acetate (PubChem CID 64587416) has the molecular formula C13H15N3O2 and a molecular weight of 245.28 g/mol. Its IUPAC name is ethyl 2-[(6-cyano-2-pyridinyl)-cyclopropylamino]acetate.
| Compound Name | ethyl 2-[(6-cyano-2-pyridinyl)-cyclopropylamino]acetate |
|---|---|
| PubChem CID | 64587416 |
| Molecular Formula | C13H15N3O2 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | ethyl 2-[(6-cyano-2-pyridinyl)-cyclopropylamino]acetate |
| SMILES | CCOC(=O)CN(c1cccc(C#N)n1)C1CC1 |
| InChI | InChI=1S/C13H15N3O2/c1-2-18-13(17)9-16(11-6-7-11)12-5-3-4-10(8-14)15-12/h3-5,11H,2,6-7,9H2,1H3 |
| InChIKey | UERKTIKWOLBGNE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 66.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |