About 6-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]pyridine-2-carbothioamide
6-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]pyridine-2-carbothioamide (PubChem CID 64587644) has the molecular formula C13H9F2N3O2S
and a molecular weight of 309.30 g/mol. Its IUPAC name is 6-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]pyridine-2-carbothioamide.
Molecular Properties
| Compound Name | 6-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]pyridine-2-carbothioamide |
| PubChem CID | 64587644 |
| Molecular Formula | C13H9F2N3O2S |
| Molecular Weight | 309.30 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 6-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]pyridine-2-carbothioamide |
| SMILES | NC(=S)c1cccc(Nc2ccc3c(c2)OC(F)(F)O3)n1 |
| InChI | InChI=1S/C13H9F2N3O2S/c14-13(15)19-9-5-4-7(6-10(9)20-13)17-11-3-1-2-8(18-11)12(16)21/h1-6H,(H2,16,21)(H,17,18) |
| InChIKey | BRCAKUMDMGOSIG-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]pyridine-2-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]pyridine-2-carbothioamide?
The IUPAC name of 6-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]pyridine-2-carbothioamide (CID 64587644) is 6-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]pyridine-2-carbothioamide.
What is the SMILES notation for 6-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]pyridine-2-carbothioamide?
The canonical SMILES for 6-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]pyridine-2-carbothioamide is NC(=S)c1cccc(Nc2ccc3c(c2)OC(F)(F)O3)n1.
What is the InChIKey of 6-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]pyridine-2-carbothioamide?
The InChIKey is BRCAKUMDMGOSIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9F2N3O2S/c14-13(15)19-9-5-4-7(6-10(9)20-13)17-11-3-1-2-8(18-11)12(16)21/h1-6H,(H2,16,21)(H,17,18).
What are the key properties of 6-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]pyridine-2-carbothioamide?
6-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]pyridine-2-carbothioamide has a molecular weight of 309.30 g/mol, XLogP of 2.78, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2,2-difluoro-1,3-benzodioxol-5-yl)amino]pyridine-2-carbothioamide is sourced from PubChem (CID 64587644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).