C15H21NO3S — CID 6458857
3-(benzenesulfonyl)-N-cyclohexylpropanamide (PubChem CID 6458857) has the molecular formula C15H21NO3S and a molecular weight of 295.40 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-cyclohexylpropanamide.
| Compound Name | 3-(benzenesulfonyl)-N-cyclohexylpropanamide |
|---|---|
| PubChem CID | 6458857 |
| Molecular Formula | C15H21NO3S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 3-(benzenesulfonyl)-N-cyclohexylpropanamide |
| SMILES | O=C(CCS(=O)(=O)c1ccccc1)NC1CCCCC1 |
| InChI | InChI=1S/C15H21NO3S/c17-15(16-13-7-3-1-4-8-13)11-12-20(18,19)14-9-5-2-6-10-14/h2,5-6,9-10,13H,1,3-4,7-8,11-12H2,(H,16,17) |
| InChIKey | KFVBEEXUEPTUJB-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |