C16H16N4S — CID 64588910
4-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)quinazoline-4,6-diamine (PubChem CID 64588910) has the molecular formula C16H16N4S and a molecular weight of 296.40 g/mol. Its IUPAC name is 4-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)quinazoline-4,6-diamine.
| Compound Name | 4-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)quinazoline-4,6-diamine |
|---|---|
| PubChem CID | 64588910 |
| Molecular Formula | C16H16N4S |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 4-N-(4,5,6,7-tetrahydro-1-benzothiophen-4-yl)quinazoline-4,6-diamine |
| SMILES | Nc1ccc2ncnc(NC3CCCc4sccc43)c2c1 |
| InChI | InChI=1S/C16H16N4S/c17-10-4-5-13-12(8-10)16(19-9-18-13)20-14-2-1-3-15-11(14)6-7-21-15/h4-9,14H,1-3,17H2,(H,18,19,20) |
| InChIKey | VQANQPRAWSNVKL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|