C10H7N5S2 — CID 64589134
4-(1,3,4-thiadiazol-2-ylsulfanyl)quinazolin-6-amine (PubChem CID 64589134) has the molecular formula C10H7N5S2 and a molecular weight of 261.34 g/mol. Its IUPAC name is 4-(1,3,4-thiadiazol-2-ylsulfanyl)quinazolin-6-amine.
| Compound Name | 4-(1,3,4-thiadiazol-2-ylsulfanyl)quinazolin-6-amine |
|---|---|
| PubChem CID | 64589134 |
| Molecular Formula | C10H7N5S2 |
| Molecular Weight | 261.34 g/mol |
| Exact Mass | 261.01 |
| IUPAC Name | 4-(1,3,4-thiadiazol-2-ylsulfanyl)quinazolin-6-amine |
| SMILES | Nc1ccc2ncnc(Sc3nncs3)c2c1 |
| InChI | InChI=1S/C10H7N5S2/c11-6-1-2-8-7(3-6)9(13-4-12-8)17-10-15-14-5-16-10/h1-5H,11H2 |
| InChIKey | VLKTXNJXBXHXAZ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 77.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|