About 4-(2,2,6-trimethylmorpholin-4-yl)quinazolin-6-amine
4-(2,2,6-trimethylmorpholin-4-yl)quinazolin-6-amine (PubChem CID 64590100) has the molecular formula C15H20N4O
and a molecular weight of 272.35 g/mol. Its IUPAC name is 4-(2,2,6-trimethylmorpholin-4-yl)quinazolin-6-amine.
Molecular Properties
| Compound Name | 4-(2,2,6-trimethylmorpholin-4-yl)quinazolin-6-amine |
| PubChem CID | 64590100 |
| Molecular Formula | C15H20N4O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | 4-(2,2,6-trimethylmorpholin-4-yl)quinazolin-6-amine |
| SMILES | CC1CN(c2ncnc3ccc(N)cc23)CC(C)(C)O1 |
| InChI | InChI=1S/C15H20N4O/c1-10-7-19(8-15(2,3)20-10)14-12-6-11(16)4-5-13(12)17-9-18-14/h4-6,9-10H,7-8,16H2,1-3H3 |
| InChIKey | IWUTWAUGUUWPPW-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 64.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(2,2,6-trimethylmorpholin-4-yl)quinazolin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,2,6-trimethylmorpholin-4-yl)quinazolin-6-amine?
The IUPAC name of 4-(2,2,6-trimethylmorpholin-4-yl)quinazolin-6-amine (CID 64590100) is 4-(2,2,6-trimethylmorpholin-4-yl)quinazolin-6-amine.
What is the SMILES notation for 4-(2,2,6-trimethylmorpholin-4-yl)quinazolin-6-amine?
The canonical SMILES for 4-(2,2,6-trimethylmorpholin-4-yl)quinazolin-6-amine is CC1CN(c2ncnc3ccc(N)cc23)CC(C)(C)O1.
What is the InChIKey of 4-(2,2,6-trimethylmorpholin-4-yl)quinazolin-6-amine?
The InChIKey is IWUTWAUGUUWPPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4O/c1-10-7-19(8-15(2,3)20-10)14-12-6-11(16)4-5-13(12)17-9-18-14/h4-6,9-10H,7-8,16H2,1-3H3.
What are the key properties of 4-(2,2,6-trimethylmorpholin-4-yl)quinazolin-6-amine?
4-(2,2,6-trimethylmorpholin-4-yl)quinazolin-6-amine has a molecular weight of 272.35 g/mol, XLogP of 2.22, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,2,6-trimethylmorpholin-4-yl)quinazolin-6-amine is sourced from PubChem (CID 64590100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).