About 5-methyl-N-prop-2-enyl-1,2,4-oxadiazole-3-carboxamide
5-methyl-N-prop-2-enyl-1,2,4-oxadiazole-3-carboxamide (PubChem CID 64590413) has the molecular formula C7H9N3O2
and a molecular weight of 167.17 g/mol. Its IUPAC name is 5-methyl-N-prop-2-enyl-1,2,4-oxadiazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-methyl-N-prop-2-enyl-1,2,4-oxadiazole-3-carboxamide |
| PubChem CID | 64590413 |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 g/mol |
| Exact Mass | 167.07 |
| IUPAC Name | 5-methyl-N-prop-2-enyl-1,2,4-oxadiazole-3-carboxamide |
| SMILES | C=CCNC(=O)c1noc(C)n1 |
| InChI | InChI=1S/C7H9N3O2/c1-3-4-8-7(11)6-9-5(2)12-10-6/h3H,1,4H2,2H3,(H,8,11) |
| InChIKey | IXZYATQZDYRMBO-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.17 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-N-prop-2-enyl-1,2,4-oxadiazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-prop-2-enyl-1,2,4-oxadiazole-3-carboxamide?
The IUPAC name of 5-methyl-N-prop-2-enyl-1,2,4-oxadiazole-3-carboxamide (CID 64590413) is 5-methyl-N-prop-2-enyl-1,2,4-oxadiazole-3-carboxamide.
What is the SMILES notation for 5-methyl-N-prop-2-enyl-1,2,4-oxadiazole-3-carboxamide?
The canonical SMILES for 5-methyl-N-prop-2-enyl-1,2,4-oxadiazole-3-carboxamide is C=CCNC(=O)c1noc(C)n1.
What is the InChIKey of 5-methyl-N-prop-2-enyl-1,2,4-oxadiazole-3-carboxamide?
The InChIKey is IXZYATQZDYRMBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3O2/c1-3-4-8-7(11)6-9-5(2)12-10-6/h3H,1,4H2,2H3,(H,8,11).
What are the key properties of 5-methyl-N-prop-2-enyl-1,2,4-oxadiazole-3-carboxamide?
5-methyl-N-prop-2-enyl-1,2,4-oxadiazole-3-carboxamide has a molecular weight of 167.17 g/mol, XLogP of 0.29, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-prop-2-enyl-1,2,4-oxadiazole-3-carboxamide is sourced from PubChem (CID 64590413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).