About 2-[(2,4,6-trifluorophenyl)sulfonylamino]acetamide
2-[(2,4,6-trifluorophenyl)sulfonylamino]acetamide (PubChem CID 64590449) has the molecular formula C8H7F3N2O3S
and a molecular weight of 268.22 g/mol. Its IUPAC name is 2-[(2,4,6-trifluorophenyl)sulfonylamino]acetamide.
Molecular Properties
| Compound Name | 2-[(2,4,6-trifluorophenyl)sulfonylamino]acetamide |
| PubChem CID | 64590449 |
| Molecular Formula | C8H7F3N2O3S |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 2-[(2,4,6-trifluorophenyl)sulfonylamino]acetamide |
| SMILES | NC(=O)CNS(=O)(=O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C8H7F3N2O3S/c9-4-1-5(10)8(6(11)2-4)17(15,16)13-3-7(12)14/h1-2,13H,3H2,(H2,12,14) |
| InChIKey | VDFRISIVNONJEF-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2,4,6-trifluorophenyl)sulfonylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2,4,6-trifluorophenyl)sulfonylamino]acetamide?
The IUPAC name of 2-[(2,4,6-trifluorophenyl)sulfonylamino]acetamide (CID 64590449) is 2-[(2,4,6-trifluorophenyl)sulfonylamino]acetamide.
What is the SMILES notation for 2-[(2,4,6-trifluorophenyl)sulfonylamino]acetamide?
The canonical SMILES for 2-[(2,4,6-trifluorophenyl)sulfonylamino]acetamide is NC(=O)CNS(=O)(=O)c1c(F)cc(F)cc1F.
What is the InChIKey of 2-[(2,4,6-trifluorophenyl)sulfonylamino]acetamide?
The InChIKey is VDFRISIVNONJEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7F3N2O3S/c9-4-1-5(10)8(6(11)2-4)17(15,16)13-3-7(12)14/h1-2,13H,3H2,(H2,12,14).
What are the key properties of 2-[(2,4,6-trifluorophenyl)sulfonylamino]acetamide?
2-[(2,4,6-trifluorophenyl)sulfonylamino]acetamide has a molecular weight of 268.22 g/mol, XLogP of -0.13, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4,6-trifluorophenyl)sulfonylamino]acetamide is sourced from PubChem (CID 64590449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).