About 1-N-benzyl-4-N-cyclohexylpiperidine-1,4-dicarboxamide
1-N-benzyl-4-N-cyclohexylpiperidine-1,4-dicarboxamide (PubChem CID 645918) has the molecular formula C20H29N3O2
and a molecular weight of 343.47 g/mol. Its IUPAC name is 1-N-benzyl-4-N-cyclohexylpiperidine-1,4-dicarboxamide.
Molecular Properties
| Compound Name | 1-N-benzyl-4-N-cyclohexylpiperidine-1,4-dicarboxamide |
| PubChem CID | 645918 |
| Molecular Formula | C20H29N3O2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.23 |
| IUPAC Name | 1-N-benzyl-4-N-cyclohexylpiperidine-1,4-dicarboxamide |
| SMILES | O=C(NC1CCCCC1)C1CCN(C(=O)NCc2ccccc2)CC1 |
| InChI | InChI=1S/C20H29N3O2/c24-19(22-18-9-5-2-6-10-18)17-11-13-23(14-12-17)20(25)21-15-16-7-3-1-4-8-16/h1,3-4,7-8,17-18H,2,5-6,9-15H2,(H,21,25)(H,22,24) |
| InChIKey | IZKOOKHGCPJSNC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-N-benzyl-4-N-cyclohexylpiperidine-1,4-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-benzyl-4-N-cyclohexylpiperidine-1,4-dicarboxamide?
The IUPAC name of 1-N-benzyl-4-N-cyclohexylpiperidine-1,4-dicarboxamide (CID 645918) is 1-N-benzyl-4-N-cyclohexylpiperidine-1,4-dicarboxamide.
What is the SMILES notation for 1-N-benzyl-4-N-cyclohexylpiperidine-1,4-dicarboxamide?
The canonical SMILES for 1-N-benzyl-4-N-cyclohexylpiperidine-1,4-dicarboxamide is O=C(NC1CCCCC1)C1CCN(C(=O)NCc2ccccc2)CC1.
What is the InChIKey of 1-N-benzyl-4-N-cyclohexylpiperidine-1,4-dicarboxamide?
The InChIKey is IZKOOKHGCPJSNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H29N3O2/c24-19(22-18-9-5-2-6-10-18)17-11-13-23(14-12-17)20(25)21-15-16-7-3-1-4-8-16/h1,3-4,7-8,17-18H,2,5-6,9-15H2,(H,21,25)(H,22,24).
What are the key properties of 1-N-benzyl-4-N-cyclohexylpiperidine-1,4-dicarboxamide?
1-N-benzyl-4-N-cyclohexylpiperidine-1,4-dicarboxamide has a molecular weight of 343.47 g/mol, XLogP of 3.06, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-benzyl-4-N-cyclohexylpiperidine-1,4-dicarboxamide is sourced from PubChem (CID 645918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).