About N-hexan-2-ylbutanamide
N-hexan-2-ylbutanamide (PubChem CID 64592038) has the molecular formula C10H21NO
and a molecular weight of 171.28 g/mol. Its IUPAC name is N-hexan-2-ylbutanamide.
Molecular Properties
| Compound Name | N-hexan-2-ylbutanamide |
| PubChem CID | 64592038 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | N-hexan-2-ylbutanamide |
| SMILES | CCCCC(C)NC(=O)CCC |
| InChI | InChI=1S/C10H21NO/c1-4-6-8-9(3)11-10(12)7-5-2/h9H,4-8H2,1-3H3,(H,11,12) |
| InChIKey | WMQPJZDHFDFOAN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-hexan-2-ylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hexan-2-ylbutanamide?
The IUPAC name of N-hexan-2-ylbutanamide (CID 64592038) is N-hexan-2-ylbutanamide.
What is the SMILES notation for N-hexan-2-ylbutanamide?
The canonical SMILES for N-hexan-2-ylbutanamide is CCCCC(C)NC(=O)CCC.
What is the InChIKey of N-hexan-2-ylbutanamide?
The InChIKey is WMQPJZDHFDFOAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO/c1-4-6-8-9(3)11-10(12)7-5-2/h9H,4-8H2,1-3H3,(H,11,12).
What are the key properties of N-hexan-2-ylbutanamide?
N-hexan-2-ylbutanamide has a molecular weight of 171.28 g/mol, XLogP of 2.48, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-hexan-2-ylbutanamide is sourced from PubChem (CID 64592038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).