C11H24N2O2S — CID 64592514
N-(2,2,6,6-tetramethylpiperidin-4-yl)ethanesulfonamide (PubChem CID 64592514) has the molecular formula C11H24N2O2S and a molecular weight of 248.39 g/mol. Its IUPAC name is N-(2,2,6,6-tetramethylpiperidin-4-yl)ethanesulfonamide.
| Compound Name | N-(2,2,6,6-tetramethylpiperidin-4-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 64592514 |
| Molecular Formula | C11H24N2O2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | N-(2,2,6,6-tetramethylpiperidin-4-yl)ethanesulfonamide |
| SMILES | CCS(=O)(=O)NC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C11H24N2O2S/c1-6-16(14,15)12-9-7-10(2,3)13-11(4,5)8-9/h9,12-13H,6-8H2,1-5H3 |
| InChIKey | ANNWJZGZEFVIIH-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |