About 4-ethylsulfonyl-2,3-dihydro-1,4-benzothiazine
4-ethylsulfonyl-2,3-dihydro-1,4-benzothiazine (PubChem CID 64593320) has the molecular formula C10H13NO2S2
and a molecular weight of 243.35 g/mol. Its IUPAC name is 4-ethylsulfonyl-2,3-dihydro-1,4-benzothiazine.
Molecular Properties
| Compound Name | 4-ethylsulfonyl-2,3-dihydro-1,4-benzothiazine |
| PubChem CID | 64593320 |
| Molecular Formula | C10H13NO2S2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 4-ethylsulfonyl-2,3-dihydro-1,4-benzothiazine |
| SMILES | CCS(=O)(=O)N1CCSc2ccccc21 |
| InChI | InChI=1S/C10H13NO2S2/c1-2-15(12,13)11-7-8-14-10-6-4-3-5-9(10)11/h3-6H,2,7-8H2,1H3 |
| InChIKey | BLOOYGXZCRNHBY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethylsulfonyl-2,3-dihydro-1,4-benzothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylsulfonyl-2,3-dihydro-1,4-benzothiazine?
The IUPAC name of 4-ethylsulfonyl-2,3-dihydro-1,4-benzothiazine (CID 64593320) is 4-ethylsulfonyl-2,3-dihydro-1,4-benzothiazine.
What is the SMILES notation for 4-ethylsulfonyl-2,3-dihydro-1,4-benzothiazine?
The canonical SMILES for 4-ethylsulfonyl-2,3-dihydro-1,4-benzothiazine is CCS(=O)(=O)N1CCSc2ccccc21.
What is the InChIKey of 4-ethylsulfonyl-2,3-dihydro-1,4-benzothiazine?
The InChIKey is BLOOYGXZCRNHBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2S2/c1-2-15(12,13)11-7-8-14-10-6-4-3-5-9(10)11/h3-6H,2,7-8H2,1H3.
What are the key properties of 4-ethylsulfonyl-2,3-dihydro-1,4-benzothiazine?
4-ethylsulfonyl-2,3-dihydro-1,4-benzothiazine has a molecular weight of 243.35 g/mol, XLogP of 1.95, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylsulfonyl-2,3-dihydro-1,4-benzothiazine is sourced from PubChem (CID 64593320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).