About N,N-bis[3-(dimethylamino)propyl]-2,2-dimethylpropanamide
N,N-bis[3-(dimethylamino)propyl]-2,2-dimethylpropanamide (PubChem CID 64593392) has the molecular formula C15H33N3O
and a molecular weight of 271.45 g/mol. Its IUPAC name is N,N-bis[3-(dimethylamino)propyl]-2,2-dimethylpropanamide.
Molecular Properties
| Compound Name | N,N-bis[3-(dimethylamino)propyl]-2,2-dimethylpropanamide |
| PubChem CID | 64593392 |
| Molecular Formula | C15H33N3O |
| Molecular Weight | 271.45 g/mol |
| Exact Mass | 271.26 |
| IUPAC Name | N,N-bis[3-(dimethylamino)propyl]-2,2-dimethylpropanamide |
| SMILES | CN(C)CCCN(CCCN(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C15H33N3O/c1-15(2,3)14(19)18(12-8-10-16(4)5)13-9-11-17(6)7/h8-13H2,1-7H3 |
| InChIKey | VSWCQIQDJRCTLZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.45 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-bis[3-(dimethylamino)propyl]-2,2-dimethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis[3-(dimethylamino)propyl]-2,2-dimethylpropanamide?
The IUPAC name of N,N-bis[3-(dimethylamino)propyl]-2,2-dimethylpropanamide (CID 64593392) is N,N-bis[3-(dimethylamino)propyl]-2,2-dimethylpropanamide.
What is the SMILES notation for N,N-bis[3-(dimethylamino)propyl]-2,2-dimethylpropanamide?
The canonical SMILES for N,N-bis[3-(dimethylamino)propyl]-2,2-dimethylpropanamide is CN(C)CCCN(CCCN(C)C)C(=O)C(C)(C)C.
What is the InChIKey of N,N-bis[3-(dimethylamino)propyl]-2,2-dimethylpropanamide?
The InChIKey is VSWCQIQDJRCTLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33N3O/c1-15(2,3)14(19)18(12-8-10-16(4)5)13-9-11-17(6)7/h8-13H2,1-7H3.
What are the key properties of N,N-bis[3-(dimethylamino)propyl]-2,2-dimethylpropanamide?
N,N-bis[3-(dimethylamino)propyl]-2,2-dimethylpropanamide has a molecular weight of 271.45 g/mol, XLogP of 1.76, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis[3-(dimethylamino)propyl]-2,2-dimethylpropanamide is sourced from PubChem (CID 64593392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).