C9H6F4N2O — CID 64594578
6-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carbonitrile (PubChem CID 64594578) has the molecular formula C9H6F4N2O and a molecular weight of 234.15 g/mol. Its IUPAC name is 6-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carbonitrile.
| Compound Name | 6-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 64594578 |
| Molecular Formula | C9H6F4N2O |
| Molecular Weight | 234.15 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | 6-(2,2,3,3-tetrafluoropropoxy)pyridine-2-carbonitrile |
| SMILES | N#Cc1cccc(OCC(F)(F)C(F)F)n1 |
| InChI | InChI=1S/C9H6F4N2O/c10-8(11)9(12,13)5-16-7-3-1-2-6(4-14)15-7/h1-3,8H,5H2 |
| InChIKey | FOJOGUWPWXMSKG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.15 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|