About 6-(3,5-dimethylpyrazol-1-yl)-1H-pyrimidine-2,4-dione
6-(3,5-dimethylpyrazol-1-yl)-1H-pyrimidine-2,4-dione (PubChem CID 6459543) has the molecular formula C9H10N4O2
and a molecular weight of 206.20 g/mol. Its IUPAC name is 6-(3,5-dimethylpyrazol-1-yl)-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-(3,5-dimethylpyrazol-1-yl)-1H-pyrimidine-2,4-dione |
| PubChem CID | 6459543 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.20 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | 6-(3,5-dimethylpyrazol-1-yl)-1H-pyrimidine-2,4-dione |
| SMILES | Cc1cc(C)n(-c2cc(=O)[nH]c(=O)[nH]2)n1 |
| InChI | InChI=1S/C9H10N4O2/c1-5-3-6(2)13(12-5)7-4-8(14)11-9(15)10-7/h3-4H,1-2H3,(H2,10,11,14,15) |
| InChIKey | SQCUZZQJVWBKED-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 83.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.20 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(3,5-dimethylpyrazol-1-yl)-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3,5-dimethylpyrazol-1-yl)-1H-pyrimidine-2,4-dione?
The IUPAC name of 6-(3,5-dimethylpyrazol-1-yl)-1H-pyrimidine-2,4-dione (CID 6459543) is 6-(3,5-dimethylpyrazol-1-yl)-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 6-(3,5-dimethylpyrazol-1-yl)-1H-pyrimidine-2,4-dione?
The canonical SMILES for 6-(3,5-dimethylpyrazol-1-yl)-1H-pyrimidine-2,4-dione is Cc1cc(C)n(-c2cc(=O)[nH]c(=O)[nH]2)n1.
What is the InChIKey of 6-(3,5-dimethylpyrazol-1-yl)-1H-pyrimidine-2,4-dione?
The InChIKey is SQCUZZQJVWBKED-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2/c1-5-3-6(2)13(12-5)7-4-8(14)11-9(15)10-7/h3-4H,1-2H3,(H2,10,11,14,15).
What are the key properties of 6-(3,5-dimethylpyrazol-1-yl)-1H-pyrimidine-2,4-dione?
6-(3,5-dimethylpyrazol-1-yl)-1H-pyrimidine-2,4-dione has a molecular weight of 206.20 g/mol, XLogP of -0.13, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3,5-dimethylpyrazol-1-yl)-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 6459543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).