About N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(4-fluorophenyl)acetamide
N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(4-fluorophenyl)acetamide (PubChem CID 645966) has the molecular formula C12H13FN2OS
and a molecular weight of 252.31 g/mol. Its IUPAC name is N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(4-fluorophenyl)acetamide.
Molecular Properties
| Compound Name | N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(4-fluorophenyl)acetamide |
| PubChem CID | 645966 |
| Molecular Formula | C12H13FN2OS |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(4-fluorophenyl)acetamide |
| SMILES | CC(=O)N(C1=NCCCS1)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H13FN2OS/c1-9(16)15(12-14-7-2-8-17-12)11-5-3-10(13)4-6-11/h3-6H,2,7-8H2,1H3 |
| InChIKey | LLJNLTCWTTZGSK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(4-fluorophenyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(4-fluorophenyl)acetamide?
The IUPAC name of N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(4-fluorophenyl)acetamide (CID 645966) is N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(4-fluorophenyl)acetamide.
What is the SMILES notation for N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(4-fluorophenyl)acetamide?
The canonical SMILES for N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(4-fluorophenyl)acetamide is CC(=O)N(C1=NCCCS1)c1ccc(F)cc1.
What is the InChIKey of N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(4-fluorophenyl)acetamide?
The InChIKey is LLJNLTCWTTZGSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FN2OS/c1-9(16)15(12-14-7-2-8-17-12)11-5-3-10(13)4-6-11/h3-6H,2,7-8H2,1H3.
What are the key properties of N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(4-fluorophenyl)acetamide?
N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(4-fluorophenyl)acetamide has a molecular weight of 252.31 g/mol, XLogP of 2.67, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5,6-dihydro-4H-1,3-thiazin-2-yl)-N-(4-fluorophenyl)acetamide is sourced from PubChem (CID 645966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).